Structure of PDB 3mpm Chain A Binding Site BS01 |
|
|
Ligand ID | 5LK |
InChI | InChI=1S/C23H26N6O/c1-27-9-11-28(12-10-27)18-4-2-3-17(13-18)21-15-26-29-22(24)20(14-25-23(21)29)16-5-7-19(30)8-6-16/h2-8,13-15,20,22,30H,9-12,24H2,1H3/t20-,22+/m0/s1 |
InChIKey | KIMZUJNGIVVWNZ-RBBKRZOGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN1CCN(CC1)c2cccc(c2)c3cnn4[CH](N)[CH](C=Nc34)c5ccc(O)cc5 | OpenEye OEToolkits 1.7.0 | CN1CCN(CC1)c2cccc(c2)c3cnn4c3N=CC(C4N)c5ccc(cc5)O | CACTVS 3.370 | CN1CCN(CC1)c2cccc(c2)c3cnn4[C@@H](N)[C@@H](C=Nc34)c5ccc(O)cc5 | OpenEye OEToolkits 1.7.0 | CN1CCN(CC1)c2cccc(c2)c3cnn4c3N=C[C@H](C4N)c5ccc(cc5)O | ACDLabs 12.01 | N2=CC(c1ccc(O)cc1)C(N)n3ncc(c23)c5cccc(N4CCN(C)CC4)c5 |
|
Formula | C23 H26 N6 O |
Name | 4-{(6R,7R)-7-amino-3-[3-(4-methylpiperazin-1-yl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrimidin-6-yl}phenol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058660822
|
PDB chain | 3mpm Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|