Structure of PDB 3mkf Chain A Binding Site BS01 |
|
|
Ligand ID | CZ7 |
InChI | InChI=1S/C16H19BN4O7/c1-2-20-7-8-21(15(25)14(20)24)16(26)19-12(13(23)18-9-17(27)28)10-3-5-11(22)6-4-10/h3-8,12,22,27-28H,2,9H2,1H3,(H,18,23)(H,19,26)/t12-/m1/s1 |
InChIKey | VFZCHJQIIUDDPB-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCN1C=CN(C(=O)N[CH](C(=O)NCB(O)O)c2ccc(O)cc2)C(=O)C1=O | CACTVS 3.370 | CCN1C=CN(C(=O)N[C@@H](C(=O)NCB(O)O)c2ccc(O)cc2)C(=O)C1=O | OpenEye OEToolkits 1.7.0 | B(CNC(=O)[C@@H](c1ccc(cc1)O)NC(=O)N2C=CN(C(=O)C2=O)CC)(O)O | OpenEye OEToolkits 1.7.0 | B(CNC(=O)C(c1ccc(cc1)O)NC(=O)N2C=CN(C(=O)C2=O)CC)(O)O | ACDLabs 12.01 | O=C2C(=O)N(C=CN2C(=O)NC(c1ccc(O)cc1)C(=O)NCB(O)O)CC |
|
Formula | C16 H19 B N4 O7 |
Name | ({[(2R)-2-{[(4-ethyl-2,3-dioxo-3,4-dihydropyrazin-1(2H)-yl)carbonyl]amino}-2-(4-hydroxyphenyl)acetyl]amino}methyl)boronic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000198032142
|
PDB chain | 3mkf Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|