Structure of PDB 3m67 Chain A Binding Site BS01 |
|
|
Ligand ID | E36 |
InChI | InChI=1S/C17H14ClN3O5S2/c18-10-2-1-9(5-16(10)28(19,23)24)13(22)8-27-17-20-11-6-14-15(7-12(11)21-17)26-4-3-25-14/h1-2,5-7H,3-4,8H2,(H,20,21)(H2,19,23,24) |
InChIKey | CPDWGRXCTGPNOE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(c(cc1C(=O)CSc2[nH]c3cc4c(cc3n2)OCCO4)S(=O)(=O)N)Cl | ACDLabs 12.01 | O=S(=O)(N)c1c(Cl)ccc(c1)C(=O)CSc2nc4c(n2)cc3OCCOc3c4 | CACTVS 3.370 | N[S](=O)(=O)c1cc(ccc1Cl)C(=O)CSc2[nH]c3cc4OCCOc4cc3n2 |
|
Formula | C17 H14 Cl N3 O5 S2 |
Name | 2-chloro-5-[(6,7-dihydro-1H-[1,4]dioxino[2,3-f]benzimidazol-2-ylsulfanyl)acetyl]benzenesulfonamide |
ChEMBL | CHEMBL1232443 |
DrugBank | |
ZINC | ZINC000058650314
|
PDB chain | 3m67 Chain A Residue 262
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|