Structure of PDB 3m5c Chain A Binding Site BS01 |
|
|
Ligand ID | PA9 |
InChI | InChI=1S/C9H17N2O7P/c1-6(12)11-7(9(14)15)3-2-4-10-8(13)5-19(16,17)18/h7H,2-5H2,1H3,(H,10,13)(H,11,12)(H,14,15)(H2,16,17,18)/t7-/m0/s1 |
InChIKey | KUGZSRGMHASJIM-ZETCQYMHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(=O)NC(CCCNC(=O)CP(=O)(O)O)C(=O)O | ACDLabs 10.04 | O=C(NCCCC(C(=O)O)NC(=O)C)CP(=O)(O)O | CACTVS 3.341 | CC(=O)N[CH](CCCNC(=O)C[P](O)(O)=O)C(O)=O | CACTVS 3.341 | CC(=O)N[C@@H](CCCNC(=O)C[P](O)(O)=O)C(O)=O | OpenEye OEToolkits 1.5.0 | CC(=O)N[C@@H](CCCNC(=O)CP(=O)(O)O)C(=O)O |
|
Formula | C9 H17 N2 O7 P |
Name | N~2~-acetyl-N~5~-(phosphonoacetyl)-L-ornithine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638599
|
PDB chain | 3m5c Chain A Residue 345
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|