Structure of PDB 3m2n Chain A Binding Site BS01 |
|
|
Ligand ID | J74 |
InChI | InChI=1S/C12H12ClN5O4S/c13-11-10(18(19)20)12(17-7-16-11)15-6-5-8-1-3-9(4-2-8)23(14,21)22/h1-4,7H,5-6H2,(H2,14,21,22)(H,15,16,17) |
InChIKey | XPZIHQXLSDNLNB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(ccc1CCNc2c(c(ncn2)Cl)[N+](=O)[O-])S(=O)(=O)N | CACTVS 3.370 | N[S](=O)(=O)c1ccc(CCNc2ncnc(Cl)c2[N+]([O-])=O)cc1 | ACDLabs 12.01 | O=S(=O)(N)c1ccc(cc1)CCNc2ncnc(Cl)c2[N+]([O-])=O |
|
Formula | C12 H12 Cl N5 O4 S |
Name | 4-{2-[(6-chloro-5-nitropyrimidin-4-yl)amino]ethyl}benzenesulfonamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000064744339
|
PDB chain | 3m2n Chain A Residue 262
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|