Structure of PDB 3lq5 Chain A Binding Site BS01 |
|
|
Ligand ID | SLQ |
InChI | InChI=1S/C24H29N7O/c1-4-19(14-32)28-24-29-22(21-23(30-24)31(15-27-21)16(2)3)26-13-17-8-10-18(11-9-17)20-7-5-6-12-25-20/h5-12,15-16,19,32H,4,13-14H2,1-3H3,(H2,26,28,29,30)/t19-/m0/s1 |
InChIKey | HOCBJBNQIQQQGT-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC[C@@H](CO)Nc1nc(NCc2ccc(cc2)c3ccccn3)c4ncn(C(C)C)c4n1 | ACDLabs 12.01 | n1c(c2ncn(c2nc1NC(CC)CO)C(C)C)NCc4ccc(c3ncccc3)cc4 | OpenEye OEToolkits 1.7.0 | CCC(CO)Nc1nc(c2c(n1)n(cn2)C(C)C)NCc3ccc(cc3)c4ccccn4 | CACTVS 3.370 | CC[CH](CO)Nc1nc(NCc2ccc(cc2)c3ccccn3)c4ncn(C(C)C)c4n1 | OpenEye OEToolkits 1.7.0 | CC[C@@H](CO)Nc1nc(c2c(n1)n(cn2)C(C)C)NCc3ccc(cc3)c4ccccn4 |
|
Formula | C24 H29 N7 O |
Name | (2S)-2-({9-(1-methylethyl)-6-[(4-pyridin-2-ylbenzyl)amino]-9H-purin-2-yl}amino)butan-1-ol |
ChEMBL | CHEMBL1615221 |
DrugBank | |
ZINC |
|
PDB chain | 3lq5 Chain A Residue 331
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|