Structure of PDB 3l5d Chain A Binding Site BS01 |
|
|
Ligand ID | BDV |
InChI | InChI=1S/C21H33N5O2/c1-5-6-11-23-20(28)24-13-16-7-9-17(10-8-16)14-26-18(27)21(4,12-15(2)3)25-19(26)22/h7-10,15H,5-6,11-14H2,1-4H3,(H2,22,25)(H2,23,24,28)/t21-/m1/s1 |
InChIKey | VPGRKPRUHRVZER-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CCCCNC(=O)NCc1ccc(CN2C(=N)N[C](C)(CC(C)C)C2=O)cc1 | CACTVS 3.352 | CCCCNC(=O)NCc1ccc(CN2C(=N)N[C@](C)(CC(C)C)C2=O)cc1 | OpenEye OEToolkits 1.7.0 | CCCCNC(=O)NCc1ccc(cc1)CN2C(=O)C(NC2=N)(C)CC(C)C | OpenEye OEToolkits 1.7.0 | [H]/N=C\1/N[C@](C(=O)N1Cc2ccc(cc2)CNC(=O)NCCCC)(C)CC(C)C |
|
Formula | C21 H33 N5 O2 |
Name | 1-butyl-3-(4-{[(2Z,4R)-2-imino-4-methyl-4-(2-methylpropyl)-5-oxoimidazolidin-1-yl]methyl}benzyl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000045258600
|
PDB chain | 3l5d Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|