Structure of PDB 3l3r Chain A Binding Site BS01 |
|
|
Ligand ID | OAG |
InChI | InChI=1S/C14H12Cl2N6/c15-8-1-2-10(16)11(4-8)19-5-7-3-9-12(17)21-14(18)22-13(9)20-6-7/h1-4,6,19H,5H2,(H4,17,18,20,21,22) |
InChIKey | RSPDQFOJWPXTPN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(c(cc1Cl)NCc2cc3c(nc(nc3nc2)N)N)Cl | CACTVS 3.352 | Nc1nc(N)c2cc(CNc3cc(Cl)ccc3Cl)cnc2n1 |
|
Formula | C14 H12 Cl2 N6 |
Name | 6-{[(2,5-dichlorophenyl)amino]methyl}pyrido[2,3-d]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL145979 |
DrugBank | |
ZINC | ZINC000005973982
|
PDB chain | 3l3r Chain A Residue 187
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L22 E30 |
Catalytic site (residue number reindexed from 1) |
L22 E30 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|