Structure of PDB 3l3m Chain A Binding Site BS01 |
|
|
Ligand ID | A92 |
InChI | InChI=1S/C19H19FN4O/c20-14-10-11(15-5-1-2-9-22-15)7-8-12(14)19-23-16-6-3-4-13(18(21)25)17(16)24-19/h3-4,6-8,10,15,22H,1-2,5,9H2,(H2,21,25)(H,23,24)/t15-/m0/s1 |
InChIKey | LGVIXHMVSRYWJL-HNNXBMFYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(c2c(c1)nc([nH]2)c3ccc(cc3F)C4CCCCN4)C(=O)N | CACTVS 3.352 | NC(=O)c1cccc2nc([nH]c12)c3ccc(cc3F)[CH]4CCCCN4 | CACTVS 3.352 | NC(=O)c1cccc2nc([nH]c12)c3ccc(cc3F)[C@@H]4CCCCN4 | OpenEye OEToolkits 1.7.0 | c1cc(c2c(c1)nc([nH]2)c3ccc(cc3F)[C@@H]4CCCCN4)C(=O)N |
|
Formula | C19 H19 F N4 O |
Name | 2-{2-fluoro-4-[(2S)-piperidin-2-yl]phenyl}-1H-benzimidazole-7-carboxamide |
ChEMBL | CHEMBL1089125 |
DrugBank | |
ZINC | ZINC000049066661
|
PDB chain | 3l3m Chain A Residue 351
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|