Structure of PDB 3kvz Chain A Binding Site BS01 |
|
|
Ligand ID | ENV |
InChI | InChI=1S/C14H25FN2O5/c1-14(2,9-18)12(21)13(22)17-7-5-11(20)16-6-3-4-10(19)8-15/h12,18,21H,3-9H2,1-2H3,(H,16,20)(H,17,22)/t12-/m0/s1 |
InChIKey | FTHCNOQGZZPFFG-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCCC(=O)CF)O | OpenEye OEToolkits 1.7.0 | CC(C)(CO)C(C(=O)NCCC(=O)NCCCC(=O)CF)O | CACTVS 3.370 | CC(C)(CO)[CH](O)C(=O)NCCC(=O)NCCCC(=O)CF | CACTVS 3.370 | CC(C)(CO)[C@@H](O)C(=O)NCCC(=O)NCCCC(=O)CF | ACDLabs 12.01 | O=C(NCCC(=O)NCCCC(=O)CF)C(O)C(C)(C)CO |
|
Formula | C14 H25 F N2 O5 |
Name | (2R)-N-{3-[(5-fluoro-4-oxopentyl)amino]-3-oxopropyl}-2,4-dihydroxy-3,3-dimethylbutanamide; Fluoroacetyl carba(dethia)-pantetheine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650412
|
PDB chain | 3kvz Chain B Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.2.29: fluoroacetyl-CoA thioesterase. |
|
|
|