Structure of PDB 3krj Chain A Binding Site BS01 |
|
|
Ligand ID | KRJ |
InChI | InChI=1S/C22H25N5O/c23-13-18-14-25-21(26-18)22(28)27-20-7-6-17(15-8-10-24-11-9-15)12-19(20)16-4-2-1-3-5-16/h4,6-7,12,14-15,24H,1-3,5,8-11H2,(H,25,26)(H,27,28) |
InChIKey | XPCQXAQALLRVJQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O=C(Nc1ccc(cc1C2=CCCCC2)C3CCNCC3)c4[nH]cc(n4)C#N | OpenEye OEToolkits 1.7.0 | c1cc(c(cc1C2CCNCC2)C3=CCCCC3)NC(=O)c4[nH]cc(n4)C#N |
|
Formula | C22 H25 N5 O |
Name | 4-cyano-N-(2-cyclohex-1-en-1-yl-4-piperidin-4-ylphenyl)-1H-imidazole-2-carboxamide |
ChEMBL | CHEMBL257154 |
DrugBank | |
ZINC | ZINC000029046735
|
PDB chain | 3krj Chain A Residue 923
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|