Structure of PDB 3kl6 Chain A Binding Site BS01 |
|
|
Ligand ID | 443 |
InChI | InChI=1S/C22H26ClN3O5S/c23-17-4-2-16-13-19(5-3-15(16)12-17)32(30,31)14-20(27)21(28)25-10-6-18(7-11-25)26-9-1-8-24-22(26)29/h2-5,12-13,18,20,27H,1,6-11,14H2,(H,24,29)/t20-/m1/s1 |
InChIKey | GEHAEMCVKDPMKO-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O[C@H](C[S](=O)(=O)c1ccc2cc(Cl)ccc2c1)C(=O)N3CC[C@@H](CC3)N4CCCNC4=O | OpenEye OEToolkits 1.7.0 | c1cc(cc2c1cc(cc2)Cl)S(=O)(=O)C[C@H](C(=O)N3CCC(CC3)N4CCCNC4=O)O | CACTVS 3.352 | O[CH](C[S](=O)(=O)c1ccc2cc(Cl)ccc2c1)C(=O)N3CC[CH](CC3)N4CCCNC4=O | OpenEye OEToolkits 1.7.0 | c1cc(cc2c1cc(cc2)Cl)S(=O)(=O)CC(C(=O)N3CCC(CC3)N4CCCNC4=O)O |
|
Formula | C22 H26 Cl N3 O5 S |
Name | 1-(1-{(2S)-3-[(6-chloronaphthalen-2-yl)sulfonyl]-2-hydroxypropanoyl}piperidin-4-yl)tetrahydropyrimidin-2(1H)-one |
ChEMBL | CHEMBL1095032 |
DrugBank | DB11984 |
ZINC | ZINC000013986542
|
PDB chain | 3kl6 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|