Structure of PDB 3ki5 Chain A Binding Site BS01 |
|
|
Ligand ID | G9M |
InChI | InChI=1S/C23H27N5O2/c29-21(15-27-13-9-16(10-14-27)28-11-3-4-12-28)25-20-8-7-19-22(26-20)17-5-1-2-6-18(17)23(30)24-19/h1-2,5-8,16H,3-4,9-15H2,(H,24,30)(H,25,26,29) |
InChIKey | XEKQXWYAIADGIV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O=C(CN1CCC(CC1)N2CCCC2)Nc3ccc4NC(=O)c5ccccc5c4n3 | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)-c3c(ccc(n3)NC(=O)CN4CCC(CC4)N5CCCC5)NC2=O |
|
Formula | C23 H27 N5 O2 |
Name | N-(6-oxo-5,6-dihydrobenzo[c][1,5]naphthyridin-2-yl)-2-(4-pyrrolidin-1-ylpiperidin-1-yl)acetamide |
ChEMBL | CHEMBL1194010 |
DrugBank | |
ZINC | ZINC000003815860
|
PDB chain | 3ki5 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E581 |
Catalytic site (residue number reindexed from 1) |
E152 |
Enzyme Commision number |
2.4.2.36: NAD(+)--diphthamide ADP-ribosyltransferase. |
|
|
|