Structure of PDB 3ki3 Chain A Binding Site BS01 |
|
|
Ligand ID | G9H |
InChI | InChI=1S/C13H16N4O/c1-16(2)8-11-15-10-5-3-4-9-12(10)17(11)7-6-14-13(9)18/h3-5H,6-8H2,1-2H3,(H,14,18) |
InChIKey | QRQMULXVGGGLGB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CN(C)Cc1nc2cccc3C(=O)NCCn1c23 | OpenEye OEToolkits 1.7.0 | CN(C)Cc1nc2cccc3c2n1CCNC3=O |
|
Formula | C13 H16 N4 O |
Name | 2-[(dimethylamino)methyl]-5,6-dihydroimidazo[4,5,1-jk][1,4]benzodiazepin-7(4H)-one; 1-Dimethylaminomethyl-8,9-dihydro-7H-2,7,9a-triaza-benzo[cd]azulen-6-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013858429
|
PDB chain | 3ki3 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E581 |
Catalytic site (residue number reindexed from 1) |
E146 |
Enzyme Commision number |
2.4.2.36: NAD(+)--diphthamide ADP-ribosyltransferase. |
|
|
|