Structure of PDB 3kba Chain A Binding Site BS01 |
|
|
Ligand ID | WOW |
InChI | InChI=1S/C20H22ClN3O2S/c1-15-5-3-4-6-17(15)13-24(18-8-7-16(12-22)20(21)11-18)19-9-10-23(14-19)27(2,25)26/h3-8,11,19H,9-10,13-14H2,1-2H3/t19-/m0/s1 |
InChIKey | OTRAFCFYTZJLKH-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | Cc1ccccc1CN([CH]2CCN(C2)[S](C)(=O)=O)c3ccc(C#N)c(Cl)c3 | OpenEye OEToolkits 1.7.0 | Cc1ccccc1CN(c2ccc(c(c2)Cl)C#N)[C@H]3CC[N@@](C3)S(=O)(=O)C | CACTVS 3.352 | Cc1ccccc1CN([C@H]2CCN(C2)[S](C)(=O)=O)c3ccc(C#N)c(Cl)c3 | OpenEye OEToolkits 1.7.0 | Cc1ccccc1CN(c2ccc(c(c2)Cl)C#N)C3CCN(C3)S(=O)(=O)C | ACDLabs 11.02 | O=S(=O)(N3CCC(N(c1ccc(C#N)c(Cl)c1)Cc2ccccc2C)C3)C |
|
Formula | C20 H22 Cl N3 O2 S |
Name | 2-chloro-4-{(2-methylbenzyl)[(3S)-1-(methylsulfonyl)pyrrolidin-3-yl]amino}benzonitrile |
ChEMBL | CHEMBL601500 |
DrugBank | |
ZINC | ZINC000044460291
|
PDB chain | 3kba Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|