Structure of PDB 3kb7 Chain A Binding Site BS01 |
|
|
Ligand ID | 071 |
InChI | InChI=1S/C23H28N8O2/c1-29-8-10-31(11-9-29)15-5-7-18(33-3)17(12-15)26-23-25-13-14-4-6-16-20(22(24)32)28-30(2)21(16)19(14)27-23/h5,7,12-13H,4,6,8-11H2,1-3H3,(H2,24,32)(H,25,26,27) |
InChIKey | SWTRIZHCIUWGAU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=C(c2nn(c3c1nc(ncc1CCc23)Nc5cc(N4CCN(C)CC4)ccc5OC)C)N | OpenEye OEToolkits 1.7.0 | Cn1c-2c(c(n1)C(=O)N)CCc3c2nc(nc3)Nc4cc(ccc4OC)N5CCN(CC5)C | CACTVS 3.352 | COc1ccc(cc1Nc2ncc3CCc4c(nn(C)c4c3n2)C(N)=O)N5CCN(C)CC5 |
|
Formula | C23 H28 N8 O2 |
Name | 8-{[2-methoxy-5-(4-methylpiperazin-1-yl)phenyl]amino}-1-methyl-4,5-dihydro-1H-pyrazolo[4,3-h]quinazoline-3-carboxamide |
ChEMBL | CHEMBL1094408 |
DrugBank | |
ZINC | ZINC000049113058
|
PDB chain | 3kb7 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|