Structure of PDB 3k98 Chain A Binding Site BS01 |
|
|
Ligand ID | 1RC |
InChI | InChI=1S/C18H17ClN2O4/c1-2-20-17(24)16-11-6-4-3-5-10(11)9-21(16)18(25)12-7-13(19)15(23)8-14(12)22/h3-8,16,22-23H,2,9H2,1H3,(H,20,24)/t16-/m1/s1 |
InChIKey | QITRQXXSCAOQLZ-MRXNPFEDSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | Clc1cc(c(O)cc1O)C(=O)N3C(c2ccccc2C3)C(=O)NCC | CACTVS 3.352 | CCNC(=O)[CH]1N(Cc2ccccc12)C(=O)c3cc(Cl)c(O)cc3O | CACTVS 3.352 | CCNC(=O)[C@@H]1N(Cc2ccccc12)C(=O)c3cc(Cl)c(O)cc3O | OpenEye OEToolkits 1.7.0 | CCNC(=O)C1c2ccccc2CN1C(=O)c3cc(c(cc3O)O)Cl | OpenEye OEToolkits 1.7.0 | CCNC(=O)[C@H]1c2ccccc2CN1C(=O)c3cc(c(cc3O)O)Cl |
|
Formula | C18 H17 Cl N2 O4 |
Name | (1R)-2-[(5-chloro-2,4-dihydroxyphenyl)carbonyl]-N-ethyl-2,3-dihydro-1H-isoindole-1-carboxamide; (1R)-2-(5-chloro-2,4-dihydroxybenzoyl)-N-ethylisoindoline-1-carboxamide |
ChEMBL | CHEMBL565861 |
DrugBank | |
ZINC | ZINC000036520242
|
PDB chain | 3k98 Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|