Structure of PDB 3k5x Chain A Binding Site BS01 |
|
|
Ligand ID | P8D |
InChI | InChI=1S/C7H14NO6P/c1-4(8)15(13,14)3-5(7(11)12)2-6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10)(H,11,12)(H,13,14)/t4-,5+/m1/s1 |
InChIKey | LWODXTSWCZWQHR-UHNVWZDZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | C[C@H](N)[P](O)(=O)C[C@H](CC(O)=O)C(O)=O | CACTVS 3.352 | C[CH](N)[P](O)(=O)C[CH](CC(O)=O)C(O)=O | ACDLabs 11.02 | O=P(O)(C(N)C)CC(C(=O)O)CC(=O)O | OpenEye OEToolkits 1.7.0 | CC(N)P(=O)(CC(CC(=O)O)C(=O)O)O | OpenEye OEToolkits 1.7.0 | C[C@H](N)[P@@](=O)(C[C@H](CC(=O)O)C(=O)O)O |
|
Formula | C7 H14 N O6 P |
Name | phosphinate pseudodipeptide L-Ala-D-Asp; (2R)-2-{[(R)-[(1R)-1-aminoethyl](hydroxy)phosphoryl]methyl}butanedioic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000025109138
|
PDB chain | 3k5x Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|