Structure of PDB 3jy9 Chain A Binding Site BS01 |
|
|
Ligand ID | JZH |
InChI | InChI=1S/C21H15N3O2/c25-13-7-5-12(6-8-13)18-16-11-23-20-19(16)15(9-10-22-20)14-3-1-2-4-17(14)24-21(18)26/h1-11,18,25H,(H,22,23)(H,24,26)/t18-/m0/s1 |
InChIKey | LGIBDQRYOFBMTC-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | Oc1ccc(cc1)[CH]2C(=O)Nc3ccccc3c4ccnc5[nH]cc2c45 | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)-c3ccnc4c3c(c[nH]4)[C@@H](C(=O)N2)c5ccc(cc5)O | OpenEye OEToolkits 1.7.0 | c1ccc2c(c1)-c3ccnc4c3c(c[nH]4)C(C(=O)N2)c5ccc(cc5)O | CACTVS 3.352 | Oc1ccc(cc1)[C@@H]2C(=O)Nc3ccccc3c4ccnc5[nH]cc2c45 | ACDLabs 11.02 | O=C5Nc1ccccc1c2c3c(ncc2)ncc3C5c4ccc(O)cc4 |
|
Formula | C21 H15 N3 O2 |
Name | (3S)-3-(4-hydroxyphenyl)-1,5-dihydro-1,5,12-triazabenzo[4,5]cycloocta[1,2,3-cd]inden-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000043196199
|
PDB chain | 3jy9 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|