Structure of PDB 3iok Chain A Binding Site BS01 |
|
|
Ligand ID | 1P6 |
InChI | InChI=1S/C18H16FN7/c1-11(12-3-5-13(19)6-4-12)24-15-9-14(22-10-23-15)16-17(20)25-26-8-2-7-21-18(16)26/h2-11H,1H3,(H2,20,25)(H,22,23,24)/t11-/m0/s1 |
InChIKey | PNFXHJHLWYEAPD-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C[C@@H](c1ccc(cc1)F)Nc2cc(ncn2)c3c(nn4c3nccc4)N | ACDLabs 11.02 | Fc1ccc(cc1)C(Nc4ncnc(c2c3ncccn3nc2N)c4)C | OpenEye OEToolkits 1.7.0 | CC(c1ccc(cc1)F)Nc2cc(ncn2)c3c(nn4c3nccc4)N | CACTVS 3.352 | C[CH](Nc1cc(ncn1)c2c(N)nn3cccnc23)c4ccc(F)cc4 | CACTVS 3.352 | C[C@H](Nc1cc(ncn1)c2c(N)nn3cccnc23)c4ccc(F)cc4 |
|
Formula | C18 H16 F N7 |
Name | 3-(6-{[(1S)-1-(4-fluorophenyl)ethyl]amino}pyrimidin-4-yl)pyrazolo[1,5-a]pyrimidin-2-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000044674034
|
PDB chain | 3iok Chain A Residue 1201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|