Structure of PDB 3ioe Chain A Binding Site BS01 |
|
|
Ligand ID | A7D |
InChI | InChI=1S/C14H21N5O5S/c15-12-9-13(17-5-16-12)19(6-18-9)14-11(23)10(22)8(24-14)4-25-2-1-7(21)3-20/h5-8,10-11,14,20-23H,1-4H2,(H2,15,16,17)/t7-,8-,10-,11-,14-/m1/s1 |
InChIKey | QSBLNOGMFRGVGL-BAYCTPFLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CSCC[C@@H](O)CO)[C@@H](O)[C@H]3O | CACTVS 3.352 | Nc1ncnc2n(cnc12)[CH]3O[CH](CSCC[CH](O)CO)[CH](O)[CH]3O | OpenEye OEToolkits 1.7.0 | c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CSCCC(CO)O)O)O)N | OpenEye OEToolkits 1.7.0 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CSCC[C@H](CO)O)O)O)N | ACDLabs 11.02 | n2c1c(ncnc1n(c2)C3OC(C(O)C3O)CSCCC(O)CO)N |
|
Formula | C14 H21 N5 O5 S |
Name | 5'-S-[(3R)-3,4-dihydroxybutyl]-5'-thioadenosine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650501
|
PDB chain | 3ioe Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|