Structure of PDB 3ioc Chain A Binding Site BS01 |
|
|
Ligand ID | A5D |
InChI | InChI=1S/C17H19N5O3S2/c18-15-12-16(20-8-19-15)22(9-21-12)17-14(24)13(23)11(25-17)7-27-26-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23-24H,6-7H2,(H2,18,19,20)/t11-,13-,14-,17-/m1/s1 |
InChIKey | DBQUNXDCOIKHGM-LSCFUAHRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1ccc(cc1)CSSC[C@@H]2[C@H]([C@H]([C@@H](O2)n3cnc4c3ncnc4N)O)O | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)CSSCC2C(C(C(O2)n3cnc4c3ncnc4N)O)O | CACTVS 3.352 | Nc1ncnc2n(cnc12)[CH]3O[CH](CSSCc4ccccc4)[CH](O)[CH]3O | CACTVS 3.352 | Nc1ncnc2n(cnc12)[C@@H]3O[C@H](CSSCc4ccccc4)[C@@H](O)[C@H]3O | ACDLabs 11.02 | n2c1c(ncnc1n(c2)C3OC(C(O)C3O)CSSCc4ccccc4)N |
|
Formula | C17 H19 N5 O3 S2 |
Name | (2R,3R,4S,5S)-2-(6-amino-9H-purin-9-yl)-5-[(benzyldisulfanyl)methyl]tetrahydrofuran-3,4-diol |
ChEMBL | CHEMBL1230729 |
DrugBank | |
ZINC | ZINC000058638432
|
PDB chain | 3ioc Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|