Structure of PDB 3io7 Chain A Binding Site BS01 |
|
|
Ligand ID | 1P5 |
InChI | InChI=1S/C20H26N8O/c1-3-26(4-2)20(29)14-7-5-9-27(12-14)16-11-15(23-13-24-16)17-18(21)25-28-10-6-8-22-19(17)28/h6,8,10-11,13-14H,3-5,7,9,12H2,1-2H3,(H2,21,25)/t14-/m0/s1 |
InChIKey | DKQKJWFBAJGEBC-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=C(N(CC)CC)C4CCCN(c3ncnc(c1c2ncccn2nc1N)c3)C4 | OpenEye OEToolkits 1.7.0 | CCN(CC)C(=O)[C@H]1CCC[N@@](C1)c2cc(ncn2)c3c(nn4c3nccc4)N | CACTVS 3.352 | CCN(CC)C(=O)[CH]1CCCN(C1)c2cc(ncn2)c3c(N)nn4cccnc34 | CACTVS 3.352 | CCN(CC)C(=O)[C@H]1CCCN(C1)c2cc(ncn2)c3c(N)nn4cccnc34 | OpenEye OEToolkits 1.7.0 | CCN(CC)C(=O)C1CCCN(C1)c2cc(ncn2)c3c(nn4c3nccc4)N |
|
Formula | C20 H26 N8 O |
Name | (3S)-1-[6-(2-aminopyrazolo[1,5-a]pyrimidin-3-yl)pyrimidin-4-yl]-N,N-diethylpiperidine-3-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000044673537
|
PDB chain | 3io7 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|