Structure of PDB 3in4 Chain A Binding Site BS01 |
|
|
Ligand ID | BX2 |
InChI | InChI=1S/C23H24N6O/c1-4-19-10-18(11-20(5-2)27-19)23(21(30)29(3)22(24)28-23)17-8-6-7-15(9-17)16-12-25-14-26-13-16/h6-14H,4-5H2,1-3H3,(H2,24,28)/t23-/m0/s1 |
InChIKey | QQPRKWVAAAEILV-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CCc1cc(cc(CC)n1)[C@@]2(N=C(N)N(C)C2=O)c3cccc(c3)c4cncnc4 | ACDLabs 11.02 | O=C2N(C(=NC2(c1cc(nc(c1)CC)CC)c4cccc(c3cncnc3)c4)N)C | OpenEye OEToolkits 1.7.0 | CCc1cc(cc(n1)CC)C2(C(=O)N(C(=N2)N)C)c3cccc(c3)c4cncnc4 | OpenEye OEToolkits 1.7.0 | CCc1cc(cc(n1)CC)[C@]2(C(=O)N(C(=N2)N)C)c3cccc(c3)c4cncnc4 | CACTVS 3.352 | CCc1cc(cc(CC)n1)[C]2(N=C(N)N(C)C2=O)c3cccc(c3)c4cncnc4 |
|
Formula | C23 H24 N6 O |
Name | (5S)-2-amino-5-(2,6-diethylpyridin-4-yl)-3-methyl-5-(3-pyrimidin-5-ylphenyl)-3,5-dihydro-4H-imidazol-4-one |
ChEMBL | CHEMBL590730 |
DrugBank | |
ZINC | ZINC000038798476
|
PDB chain | 3in4 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|