Structure of PDB 3in3 Chain A Binding Site BS01 |
|
|
Ligand ID | 472 |
InChI | InChI=1S/C20H17N5O/c1-25-18(26)20(24-19(25)21,16-7-10-22-11-8-16)17-6-2-4-14(12-17)15-5-3-9-23-13-15/h2-13H,1H3,(H2,21,24)/t20-/m1/s1 |
InChIKey | AIKOTXHNUIYVMD-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CN1C(=N[C](c2ccncc2)(c3cccc(c3)c4cccnc4)C1=O)N | ACDLabs 11.02 | O=C2N(C(=NC2(c1ccncc1)c4cccc(c3cccnc3)c4)N)C | CACTVS 3.352 | CN1C(=N[C@](c2ccncc2)(c3cccc(c3)c4cccnc4)C1=O)N | OpenEye OEToolkits 1.7.0 | CN1C(=O)C(N=C1N)(c2ccncc2)c3cccc(c3)c4cccnc4 | OpenEye OEToolkits 1.7.0 | CN1C(=O)[C@@](N=C1N)(c2ccncc2)c3cccc(c3)c4cccnc4 |
|
Formula | C20 H17 N5 O |
Name | (5S)-2-amino-3-methyl-5-pyridin-4-yl-5-(3-pyridin-3-ylphenyl)-3,5-dihydro-4H-imidazol-4-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000034804867
|
PDB chain | 3in3 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|