Structure of PDB 3igb Chain A Binding Site BS01 |
|
|
Ligand ID | 454 |
InChI | InChI=1S/C18H18N4/c19-17-21-18(14-8-3-1-4-9-14,15-10-5-2-6-11-15)16-20-12-7-13-22(16)17/h1-6,8-11H,7,12-13H2,(H2,19,21) |
InChIKey | UFWSJOVQEPTPNE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | NC1=NC(c2ccccc2)(c3ccccc3)C4=NCCCN14 | ACDLabs 11.02 | N2=C(N)N1C(=NCCC1)C2(c3ccccc3)c4ccccc4 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C2(C3=NCCCN3C(=N2)N)c4ccccc4 |
|
Formula | C18 H18 N4 |
Name | 8,8-diphenyl-2,3,4,8-tetrahydroimidazo[1,5-a]pyrimidin-6-amine |
ChEMBL | CHEMBL582044 |
DrugBank | |
ZINC | ZINC000034657615
|
PDB chain | 3igb Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|