Structure of PDB 3icm Chain A Binding Site BS01 |
|
|
Ligand ID | P2H |
InChI | InChI=1S/C13H15NO7P2/c15-13(22(16,17)18,23(19,20)21)10-14-8-4-7-12(9-14)11-5-2-1-3-6-11/h1-9,15H,10H2,(H3-,16,17,18,19,20,21)/p+1 |
InChIKey | ZYEONEYSNIUGRA-UHFFFAOYSA-O |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=P(O)(O)C(O)(P(=O)(O)O)C[n+]2cccc(c1ccccc1)c2 | CACTVS 3.352 | OC(C[n+]1cccc(c1)c2ccccc2)([P](O)(O)=O)[P](O)(O)=O | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)c2ccc[n+](c2)CC(O)(P(=O)(O)O)P(=O)(O)O |
|
Formula | C13 H16 N O7 P2 |
Name | 1-(2-hydroxy-2,2-diphosphonoethyl)-3-phenylpyridinium |
ChEMBL | CHEMBL196726 |
DrugBank | |
ZINC | ZINC000013643025
|
PDB chain | 3icm Chain A Residue 363
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|