Structure of PDB 3i0a Chain A Binding Site BS01 |
|
|
Ligand ID | 3ET |
InChI | InChI=1S/C16H21N3O10/c17-8(4-20)15(26)28-5-9(18)16(27)29-6-10(14(24)25)19-13(23)7-2-1-3-11(21)12(7)22/h1-3,8-10,20-22H,4-6,17-18H2,(H,19,23)(H,24,25)/t8-,9-,10+/m1/s1 |
InChIKey | ZXSIADNPWRCRTI-BBBLOLIVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[CH](CO)C(=O)OC[CH](N)C(=O)OC[CH](NC(=O)c1cccc(O)c1O)C(O)=O | OpenEye OEToolkits 1.5.0 | c1cc(c(c(c1)O)O)C(=O)NC(COC(=O)C(COC(=O)C(CO)N)N)C(=O)O | ACDLabs 10.04 | O=C(OCC(N)C(=O)OCC(C(=O)O)NC(=O)c1cccc(O)c1O)C(N)CO | CACTVS 3.341 | N[C@H](CO)C(=O)OC[C@@H](N)C(=O)OC[C@H](NC(=O)c1cccc(O)c1O)C(O)=O | OpenEye OEToolkits 1.5.0 | c1cc(c(c(c1)O)O)C(=O)N[C@@H](COC(=O)[C@@H](COC(=O)[C@@H](CO)N)N)C(=O)O |
|
Formula | C16 H21 N3 O10 |
Name | O-[(2R)-2-amino-3-(D-seryloxy)propanoyl]-N-[(2,3-dihydroxyphenyl)carbonyl]-L-serine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638627
|
PDB chain | 3i0a Chain A Residue 181
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|