Structure of PDB 3hcc Chain A Binding Site BS01 |
|
|
Ligand ID | LT3 |
InChI | InChI=1S/C12H12F3N/c13-12(14,15)9-3-1-2-6-7-4-5-8(10(6)9)11(7)16/h1-3,7-8,11H,4-5,16H2/t7-,8+,11-/m0/s1 |
InChIKey | HHIJEPNAHYLKPE-RNSXUZJQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | N[C@H]1[C@H]2CC[C@@H]1c3c2cccc3C(F)(F)F | OpenEye OEToolkits 1.5.0 | c1cc2c(c(c1)C(F)(F)F)C3CCC2C3N | OpenEye OEToolkits 1.5.0 | c1cc2c(c(c1)C(F)(F)F)[C@H]3CC[C@@H]2[C@@H]3N | CACTVS 3.341 | N[CH]1[CH]2CC[CH]1c3c2cccc3C(F)(F)F | ACDLabs 10.04 | FC(F)(F)c1cccc2c1C3CCC2C3N |
|
Formula | C12 H12 F3 N |
Name | (1S,4R,9S)-5-(trifluoromethyl)-1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000026290186
|
PDB chain | 3hcc Chain A Residue 2001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.1.1.28: phenylethanolamine N-methyltransferase. |
|
|
|