Structure of PDB 3h23 Chain A Binding Site BS01 |
|
|
Ligand ID | B54 |
InChI | InChI=1S/C14H15N5O5/c15-14-17-11(10(19-23)12(20)18-14)16-6-1-7-24-9-4-2-8(3-5-9)13(21)22/h2-5H,1,6-7H2,(H,21,22)(H4,15,16,17,18,20) |
InChIKey | DEMFGJNJURCTNT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(ccc1C(=O)O)OCCCNC2=C(C(=O)NC(=N2)N)N=O | CACTVS 3.341 | NC1=NC(=C(N=O)C(=O)N1)NCCCOc2ccc(cc2)C(O)=O | ACDLabs 10.04 | O=C1C(N=O)=C(N=C(N)N1)NCCCOc2ccc(C(=O)O)cc2 |
|
Formula | C14 H15 N5 O5 |
Name | 4-{3-[(2-amino-5-nitroso-6-oxo-1,6-dihydropyrimidin-4-yl)amino]propoxy}benzoic acid |
ChEMBL | CHEMBL161604 |
DrugBank | |
ZINC | ZINC000027738522
|
PDB chain | 3h23 Chain A Residue 511
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|