Structure of PDB 3h21 Chain A Binding Site BS01 |
|
|
Ligand ID | B52 |
InChI | InChI=1S/C10H11N5O4/c1-3(9(18)19)5-6(16)4-7(15(2)14-5)12-10(11)13-8(4)17/h3H,1-2H3,(H,18,19)(H3,11,12,13,17)/t3-/m1/s1 |
InChIKey | XUKTUWRGSZSUGO-GSVOUGTGSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C(O)C(C1=NN(C=2N=C(NC(=O)C=2C1=O)N)C)C | CACTVS 3.341 | C[CH](C(O)=O)C1=NN(C)C2=C(C(=O)NC(=N2)N)C1=O | CACTVS 3.341 | C[C@@H](C(O)=O)C1=NN(C)C2=C(C(=O)NC(=N2)N)C1=O | OpenEye OEToolkits 1.5.0 | C[C@H](C1=NN(C2=C(C1=O)C(=O)NC(=N2)N)C)C(=O)O | OpenEye OEToolkits 1.5.0 | CC(C1=NN(C2=C(C1=O)C(=O)NC(=N2)N)C)C(=O)O |
|
Formula | C10 H11 N5 O4 |
Name | (2R)-2-(7-amino-1-methyl-4,5-dioxo-1,4,5,6-tetrahydropyrimido[4,5-c]pyridazin-3-yl)propanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000039233407
|
PDB chain | 3h21 Chain A Residue 278
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|