Structure of PDB 3h0w Chain A Binding Site BS01 |
|
|
Ligand ID | N8M |
InChI | InChI=1S/C13H20N6O3/c1-6-17-8-11(14)15-5-16-12(8)19(6)13-10(21)9(20)7(22-13)4-18(2)3/h5,7,9-10,13,20-21H,4H2,1-3H3,(H2,14,15,16)/t7-,9-,10-,13-/m1/s1 |
InChIKey | BDRUNDKEQQVJJG-QYVSTXNMSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN(C)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(C)nc3c(N)ncnc23 | OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1C3C(C(C(O3)CN(C)C)O)O)N | OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1[C@H]3[C@@H]([C@@H]([C@H](O3)CN(C)C)O)O)N | CACTVS 3.341 | CN(C)C[CH]1O[CH]([CH](O)[CH]1O)n2c(C)nc3c(N)ncnc23 | ACDLabs 10.04 | n2c1c(ncnc1n(c2C)C3OC(C(O)C3O)CN(C)C)N |
|
Formula | C13 H20 N6 O3 |
Name | 5'-deoxy-5'-(dimethylamino)-8-methyladenosine |
ChEMBL | CHEMBL516214 |
DrugBank | |
ZINC | ZINC000040406101
|
PDB chain | 3h0w Chain A Residue 368
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S229 H243 |
Catalytic site (residue number reindexed from 1) |
S152 H166 |
Enzyme Commision number |
4.1.1.50: adenosylmethionine decarboxylase. |
|
|
|