Structure of PDB 3ghw Chain A Binding Site BS01 |
|
|
Ligand ID | GHW |
InChI | InChI=1S/C19H18N4O6S2/c1-8-14(13-16(27)22-19(20)23-17(13)30-8)31-10-4-2-9(3-5-10)15(26)21-11(18(28)29)6-7-12(24)25/h2-5,11H,6-7H2,1H3,(H,21,26)(H,24,25)(H,28,29)(H3,20,22,23,27)/t11-/m0/s1 |
InChIKey | XZCPGLYOPFIZBL-NSHDSACASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cc1sc2N=C(N)NC(=O)c2c1Sc3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O | ACDLabs 10.04 | O=C(O)C(NC(=O)c3ccc(Sc1c(sc2N=C(NC(=O)c12)N)C)cc3)CCC(=O)O | CACTVS 3.341 | Cc1sc2N=C(N)NC(=O)c2c1Sc3ccc(cc3)C(=O)N[CH](CCC(O)=O)C(O)=O | OpenEye OEToolkits 1.5.0 | Cc1c(c2c(s1)N=C(NC2=O)N)Sc3ccc(cc3)C(=O)N[C@@H](CCC(=O)O)C(=O)O | OpenEye OEToolkits 1.5.0 | Cc1c(c2c(s1)N=C(NC2=O)N)Sc3ccc(cc3)C(=O)NC(CCC(=O)O)C(=O)O |
|
Formula | C19 H18 N4 O6 S2 |
Name | N-({4-[(2-amino-6-methyl-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-5-yl)sulfanyl]phenyl}carbonyl)-L-glutamic acid |
ChEMBL | CHEMBL562369 |
DrugBank | |
ZINC | ZINC000039274608
|
PDB chain | 3ghw Chain A Residue 187
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L22 E30 |
Catalytic site (residue number reindexed from 1) |
L22 E30 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|