Structure of PDB 3gc4 Chain A Binding Site BS01 |
|
|
Ligand ID | AAQ |
InChI | InChI=1S/C19H21N7O/c1-21-19-23-14-9-13-15(24-18(20)26-17(13)27)12(16(14)25-19)7-8-22-10-11-5-3-2-4-6-11/h2-6,9,22H,7-8,10H2,1H3,(H2,21,23,25)(H3,20,24,26,27) |
InChIKey | OCMHTFVKOKFMET-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1c3c(N=C(N1)N)c(c2nc(NC)nc2c3)CCNCc4ccccc4 | OpenEye OEToolkits 1.5.0 | CNc1[nH]c2cc3c(c(c2n1)CCNCc4ccccc4)N=C(NC3=O)N | CACTVS 3.341 | CNc1[nH]c2cc3C(=O)NC(=Nc3c(CCNCc4ccccc4)c2n1)N |
|
Formula | C19 H21 N7 O |
Name | 6-amino-4-[2-(benzylamino)ethyl]-2-(methylamino)-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058631387
|
PDB chain | 3gc4 Chain A Residue 395
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|