Structure of PDB 3fzh Chain A Binding Site BS01 |
|
|
Ligand ID | 3BH |
InChI | InChI=1S/C10H14N6O4/c11-7-4-8(14-2-13-7)16(10(12)15-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,15)(H2,11,13,14)/t3-,5-,6-,9-/m1/s1 |
InChIKey | DVGWFQILDUEEGX-UUOKFMHZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Nc1nc2c(N)ncnc2n1[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O | CACTVS 3.341 | Nc1nc2c(N)ncnc2n1[CH]3O[CH](CO)[CH](O)[CH]3O | ACDLabs 10.04 | n2c1c(ncnc1n(c2N)C3OC(C(O)C3O)CO)N | OpenEye OEToolkits 1.5.0 | c1nc(c2c(n1)n(c(n2)N)C3C(C(C(O3)CO)O)O)N | OpenEye OEToolkits 1.5.0 | c1nc(c2c(n1)n(c(n2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
|
Formula | C10 H14 N6 O4 |
Name | (2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol; 8-aminoadenosine |
ChEMBL | CHEMBL516197 |
DrugBank | |
ZINC | ZINC000005163030
|
PDB chain | 3fzh Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D10 K71 E175 D199 |
Catalytic site (residue number reindexed from 1) |
D6 K67 E171 D195 |
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|