Structure of PDB 3fup Chain A Binding Site BS01 |
|
|
Ligand ID | MI1 |
InChI | InChI=1S/C16H20N6O/c1-11-5-8-22(14(23)3-6-17)9-13(11)21(2)16-12-4-7-18-15(12)19-10-20-16/h4,7,10-11,13H,3,5,8-9H2,1-2H3,(H,18,19,20)/t11-,13+/m1/s1 |
InChIKey | UJLAWZDWDVHWOW-YPMHNXCESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@@H]1CCN(C[C@@H]1N(C)c2c3cc[nH]c3ncn2)C(=O)CC#N | CACTVS 3.341 | C[C@@H]1CCN(C[C@@H]1N(C)c2ncnc3[nH]ccc23)C(=O)CC#N | OpenEye OEToolkits 1.5.0 | CC1CCN(CC1N(C)c2c3cc[nH]c3ncn2)C(=O)CC#N | CACTVS 3.341 | C[CH]1CCN(C[CH]1N(C)c2ncnc3[nH]ccc23)C(=O)CC#N | ACDLabs 10.04 | N#CCC(=O)N3CC(N(c1ncnc2c1ccn2)C)C(C)CC3 |
|
Formula | C16 H20 N6 O |
Name | 3-{(3R,4R)-4-methyl-3-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl}-3-oxopropanenitrile; CP-690,550 |
ChEMBL | CHEMBL221959 |
DrugBank | DB08895 |
ZINC | ZINC000003818808
|
PDB chain | 3fup Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|