Structure of PDB 3fqe Chain A Binding Site BS01 |
|
|
Ligand ID | P5C |
InChI | InChI=1S/C18H24N6O/c1-11-5-4-6-12(9-11)22-17-13(16(20)25)10-21-18(24-17)23-15-8-3-2-7-14(15)19/h4-6,9-10,14-15H,2-3,7-8,19H2,1H3,(H2,20,25)(H2,21,22,23,24)/t14-,15+/m0/s1 |
InChIKey | NZNTWOVDIXCHHS-LSDHHAIUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1cccc(c1)Nc2c(cnc(n2)N[C@@H]3CCCC[C@@H]3N)C(=O)N | OpenEye OEToolkits 1.5.0 | Cc1cccc(c1)Nc2c(cnc(n2)NC3CCCCC3N)C(=O)N | CACTVS 3.341 | Cc1cccc(Nc2nc(N[CH]3CCCC[CH]3N)ncc2C(N)=O)c1 | CACTVS 3.341 | Cc1cccc(Nc2nc(N[C@@H]3CCCC[C@@H]3N)ncc2C(N)=O)c1 | ACDLabs 10.04 | O=C(c1cnc(nc1Nc2cc(ccc2)C)NC3C(N)CCCC3)N |
|
Formula | C18 H24 N6 O |
Name | 2-{[(1R,2S)-2-aminocyclohexyl]amino}-4-[(3-methylphenyl)amino]pyrimidine-5-carboxamide |
ChEMBL | CHEMBL1235110 |
DrugBank | DB08361 |
ZINC | ZINC000003941369
|
PDB chain | 3fqe Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|