Structure of PDB 3fci Chain A Binding Site BS01 |
|
|
Ligand ID | 3FI |
InChI | InChI=1S/C16H18N4O5/c21-14-8-13(19-16(24)20-14)10-17-5-2-6-25-18-9-11-3-1-4-12(7-11)15(22)23/h1,3-4,7-9,17H,2,5-6,10H2,(H,22,23)(H2,19,20,21,24)/b18-9+ |
InChIKey | DNNMFLCWPRQYIC-GIJQJNRQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)C(=O)O)\C=N\OCCCNCC2=CC(=O)NC(=O)N2 | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)C(=O)O)C=NOCCCNCC2=CC(=O)NC(=O)N2 | CACTVS 3.341 | OC(=O)c1cccc(C=NOCCCNCC2=CC(=O)NC(=O)N2)c1 | CACTVS 3.341 | OC(=O)c1cccc(\C=N\OCCCNCC2=CC(=O)NC(=O)N2)c1 | ACDLabs 10.04 | O=C1NC(=CC(=O)N1)CNCCCO\N=C\c2cccc(C(=O)O)c2 |
|
Formula | C16 H18 N4 O5 |
Name | 3-{(E)-[(3-{[(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)methyl]amino}propoxy)imino]methyl}benzoic acid |
ChEMBL | CHEMBL1213370 |
DrugBank | |
ZINC | ZINC000058592582
|
PDB chain | 3fci Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|