Structure of PDB 3emq Chain A Binding Site BS01 |
|
|
Ligand ID | HAH |
InChI | InChI=1S/C13H17NO4/c15-10-4-2-1-3-8(10)7-14-9-5-6-11(16)13(18)12(9)17/h1-6,9,11-18H,7H2/t9-,11-,12+,13+/m1/s1 |
InChIKey | IXUCFEUMPUFAGK-XEZLXBQYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[CH]1C=C[CH](NCc2ccccc2O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | c1ccc(c(c1)CN[C@@H]2C=C[C@H]([C@@H]([C@H]2O)O)O)O | CACTVS 3.341 | O[C@@H]1C=C[C@@H](NCc2ccccc2O)[C@H](O)[C@H]1O | OpenEye OEToolkits 1.5.0 | c1ccc(c(c1)CNC2C=CC(C(C2O)O)O)O | ACDLabs 10.04 | OC2C(NCc1ccccc1O)C=CC(O)C2O |
|
Formula | C13 H17 N O4 |
Name | (1S,2S,3R,6R)-6-[(2-hydroxybenzyl)amino]cyclohex-4-ene-1,2,3-triol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000035924078
|
PDB chain | 3emq Chain A Residue 1000
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.8: endo-1,4-beta-xylanase. |
|
|
|