Structure of PDB 3ekn Chain A Binding Site BS01 |
|
|
Ligand ID | GS3 |
InChI | InChI=1S/C27H31FN8O2/c1-16(2)35-11-13-36(14-12-35)17-7-8-20(22(15-17)38-3)32-27-33-25-18(9-10-30-25)26(34-27)31-21-6-4-5-19(28)23(21)24(29)37/h4-10,15-16H,11-14H2,1-3H3,(H2,29,37)(H3,30,31,32,33,34) |
InChIKey | HXZDICYKFAOZLE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | COc1cc(ccc1Nc2nc3[nH]ccc3c(Nc4cccc(F)c4C(N)=O)n2)N5CCN(CC5)C(C)C | OpenEye OEToolkits 1.5.0 | CC(C)N1CCN(CC1)c2ccc(c(c2)OC)Nc3nc4c(cc[nH]4)c(n3)Nc5cccc(c5C(=O)N)F | ACDLabs 10.04 | Fc1cccc(c1C(=O)N)Nc3nc(nc2nccc23)Nc5ccc(N4CCN(C(C)C)CC4)cc5OC |
|
Formula | C27 H31 F N8 O2 |
Name | 2-fluoro-6-{[2-({2-methoxy-4-[4-(1-methylethyl)piperazin-1-yl]phenyl}amino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino}benzamide |
ChEMBL | CHEMBL507625 |
DrugBank | |
ZINC | ZINC000053186795
|
PDB chain | 3ekn Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|