Structure of PDB 3eb0 Chain A Binding Site BS01 |
|
|
Ligand ID | DRK |
InChI | InChI=1S/C20H19N3O4/c24-11-12(25)9-10-27-23-18-14-6-2-4-8-16(14)21-19(18)17-13-5-1-3-7-15(13)22-20(17)26/h1-8,12,21,23-25H,9-11H2/t12-/m0/s1 |
InChIKey | CKLAPOFDFZKCPB-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[CH](O)CCONc1c([nH]c2ccccc12)C3=C4C=CC=CC4=NC3=O | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)c(c([nH]2)C3=C4C=CC=CC4=NC3=O)NOCCC(CO)O | ACDLabs 10.04 | O=C2N=C1C=CC=CC1=C2c4c(NOCCC(O)CO)c3ccccc3n4 | CACTVS 3.341 | OC[C@@H](O)CCONc1c([nH]c2ccccc12)C3=C4C=CC=CC4=NC3=O | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)c(c([nH]2)C3=C4C=CC=CC4=NC3=O)NOCC[C@@H](CO)O |
|
Formula | C20 H19 N3 O4 |
Name | 3-({[(3S)-3,4-dihydroxybutyl]oxy}amino)-1H,2'H-2,3'-biindol-2'-one; Indirubin_E804 |
ChEMBL | |
DrugBank | DB07676 |
ZINC | ZINC000033943519
|
PDB chain | 3eb0 Chain A Residue 384
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|