Structure of PDB 3e7o Chain A Binding Site BS01 |
|
|
Ligand ID | 35F |
InChI | InChI=1S/C20H14N6O2/c27-20(17-5-2-8-28-17)23-14-4-1-3-12(9-14)18-15-10-13(19-21-11-22-26-19)6-7-16(15)24-25-18/h1-11H,(H,23,27)(H,24,25)(H,21,22,26) |
InChIKey | LMDMJDCLPIVGQD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O=C(Nc1cccc(c1)c2n[nH]c3ccc(cc23)c4n[nH]cn4)c5occc5 | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)NC(=O)c2ccco2)c3c4cc(ccc4[nH]n3)c5nc[nH]n5 | ACDLabs 10.04 | O=C(Nc4cc(c3nnc2ccc(c1ncnn1)cc23)ccc4)c5occc5 |
|
Formula | C20 H14 N6 O2 |
Name | N-{3-[5-(1H-1,2,4-triazol-3-yl)-1H-indazol-3-yl]phenyl}furan-2-carboxamide |
ChEMBL | CHEMBL1230051 |
DrugBank | DB07020 |
ZINC | ZINC000020149009
|
PDB chain | 3e7o Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|