Structure of PDB 3dz5 Chain A Binding Site BS01 |
|
|
Ligand ID | M8M |
InChI | InChI=1S/C14H23N7O4/c1-7-19-9-12(15)17-6-18-13(9)21(7)14-11(23)10(22)8(25-14)5-20(2)3-4-24-16/h6,8,10-11,14,22-23H,3-5,16H2,1-2H3,(H2,15,17,18)/t8-,10-,11-,14-/m1/s1 |
InChIKey | MIGFZONTOHGZMB-IDTAVKCVSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1[C@H]3[C@@H]([C@@H]([C@H](O3)C[N@@](C)CCON)O)O)N | CACTVS 3.341 | CN(CCON)C[CH]1O[CH]([CH](O)[CH]1O)n2c(C)nc3c(N)ncnc23 | OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1C3C(C(C(O3)CN(C)CCON)O)O)N | CACTVS 3.341 | CN(CCON)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(C)nc3c(N)ncnc23 | ACDLabs 10.04 | n2c1c(ncnc1n(c2C)C3OC(C(O)C3O)CN(CCON)C)N |
|
Formula | C14 H23 N7 O4 |
Name | 5'-{[2-(aminooxy)ethyl](methyl)amino}-5'-deoxy-8-methyladenosine |
ChEMBL | CHEMBL1187584 |
DrugBank | |
ZINC | ZINC000040379157
|
PDB chain | 3dz5 Chain A Residue 368
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S229 H243 |
Catalytic site (residue number reindexed from 1) |
S154 H168 |
Enzyme Commision number |
4.1.1.50: adenosylmethionine decarboxylase. |
|
|
|