Structure of PDB 3dz2 Chain A Binding Site BS01 |
|
|
Ligand ID | A8M |
InChI | InChI=1S/C15H25N7O3/c1-8-20-10-13(17)18-7-19-14(10)22(8)15-12(24)11(23)9(25-15)6-21(2)5-3-4-16/h7,9,11-12,15,23-24H,3-6,16H2,1-2H3,(H2,17,18,19)/t9-,11-,12-,15-/m1/s1 |
InChIKey | PCQBSZQRAFEGGW-SDBHATRESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1C3C(C(C(O3)CN(C)CCCN)O)O)N | OpenEye OEToolkits 1.5.0 | Cc1nc2c(ncnc2n1[C@H]3[C@@H]([C@@H]([C@H](O3)C[N@@](C)CCCN)O)O)N | CACTVS 3.341 | CN(CCCN)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(C)nc3c(N)ncnc23 | ACDLabs 10.04 | n2c1c(ncnc1n(c2C)C3OC(C(O)C3O)CN(CCCN)C)N | CACTVS 3.341 | CN(CCCN)C[CH]1O[CH]([CH](O)[CH]1O)n2c(C)nc3c(N)ncnc23 |
|
Formula | C15 H25 N7 O3 |
Name | 5'-[(3-aminopropyl)(methyl)amino]-5'-deoxy-8-methyladenosine |
ChEMBL | CHEMBL1187706 |
DrugBank | |
ZINC | ZINC000040913762
|
PDB chain | 3dz2 Chain A Residue 368
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
S229 H243 |
Catalytic site (residue number reindexed from 1) |
S157 H171 |
Enzyme Commision number |
4.1.1.50: adenosylmethionine decarboxylase. |
|
|
|