Structure of PDB 3d8y Chain A Binding Site BS01 |
|
|
Ligand ID | T3S |
InChI | InChI=1S/C15H23N3O4/c1-10-8-18(15(21)16-14(10)20)13-7-11(19)12(22-13)9-17-5-3-2-4-6-17/h8,11-13,19H,2-7,9H2,1H3,(H,16,20,21)/t11-,12+,13+/m0/s1 |
InChIKey | GMOUOGHZJCSNOZ-YNEHKIRRSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CN3CCCCC3)O | CACTVS 3.341 | CC1=CN([CH]2C[CH](O)[CH](CN3CCCCC3)O2)C(=O)NC1=O | ACDLabs 10.04 | O=C1NC(=O)N(C=C1C)C2OC(C(O)C2)CN3CCCCC3 | CACTVS 3.341 | CC1=CN([C@H]2C[C@H](O)[C@@H](CN3CCCCC3)O2)C(=O)NC1=O | OpenEye OEToolkits 1.5.0 | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CN3CCCCC3)O |
|
Formula | C15 H23 N3 O4 |
Name | 5'-deoxy-5'-piperidin-1-ylthymidine |
ChEMBL | CHEMBL460910 |
DrugBank | DB08596 |
ZINC | ZINC000040864131
|
PDB chain | 3d8y Chain A Residue 127
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|