Structure of PDB 3d6q Chain A Binding Site BS01 |
|
|
Ligand ID | U3S |
InChI | InChI=1S/C14H21N3O5/c18-10-4-7-17(14(21)15-10)13-12(20)11(19)9(22-13)8-16-5-2-1-3-6-16/h4,7,9,11-13,19-20H,1-3,5-6,8H2,(H,15,18,21)/t9-,11-,12+,13+/m0/s1 |
InChIKey | PJCAMYRNNJAIMT-FTYKPCCVSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[C@@H]1[C@@H](O)[C@@H](O[C@H]1CN2CCCCC2)N3C=CC(=O)NC3=O | OpenEye OEToolkits 1.5.0 | C1CCN(CC1)C[C@H]2[C@@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O | CACTVS 3.341 | O[CH]1[CH](O)[CH](O[CH]1CN2CCCCC2)N3C=CC(=O)NC3=O | ACDLabs 10.04 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2O)CN3CCCCC3 | OpenEye OEToolkits 1.5.0 | C1CCN(CC1)CC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O |
|
Formula | C14 H21 N3 O5 |
Name | 1-(5-deoxy-5-piperidin-1-yl-alpha-L-arabinofuranosyl)pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058639054
|
PDB chain | 3d6q Chain A Residue 127
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|