Structure of PDB 3d6p Chain A Binding Site BS01 |
|
|
Ligand ID | U2S |
InChI | InChI=1S/C13H19N3O6/c17-9-1-2-16(13(20)14-9)12-11(19)10(18)8(22-12)7-15-3-5-21-6-4-15/h1-2,8,10-12,18-19H,3-7H2,(H,14,17,20)/t8-,10-,11+,12+/m0/s1 |
InChIKey | LZYQLCIKQTYBER-OHBODLIOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C1COCCN1CC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O | CACTVS 3.341 | O[CH]1[CH](O)[CH](O[CH]1CN2CCOCC2)N3C=CC(=O)NC3=O | OpenEye OEToolkits 1.5.0 | C1COCCN1C[C@H]2[C@@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O | CACTVS 3.341 | O[C@@H]1[C@@H](O)[C@@H](O[C@H]1CN2CCOCC2)N3C=CC(=O)NC3=O | ACDLabs 10.04 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2O)CN3CCOCC3 |
|
Formula | C13 H19 N3 O6 |
Name | 1-(5-deoxy-5-morpholin-4-yl-alpha-L-arabinofuranosyl)pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638925
|
PDB chain | 3d6p Chain A Residue 125
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|