Structure of PDB 3d6o Chain A Binding Site BS01 |
|
|
Ligand ID | U1S |
InChI | InChI=1S/C17H25N3O7/c1-2-26-16(24)10-3-6-19(7-4-10)9-11-13(22)14(23)15(27-11)20-8-5-12(21)18-17(20)25/h5,8,10-11,13-15,22-23H,2-4,6-7,9H2,1H3,(H,18,21,25)/t11-,13-,14+,15+/m0/s1 |
InChIKey | JCIDLMJUELAXRU-SPWCGHHHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCOC(=O)C1CCN(CC1)C[C@H]2[C@@H]([C@H]([C@@H](O2)N3C=CC(=O)NC3=O)O)O | ACDLabs 10.04 | O=C(OCC)C1CCN(CC1)CC3OC(N2C(=O)NC(=O)C=C2)C(O)C3O | CACTVS 3.341 | CCOC(=O)[CH]1CCN(CC1)C[CH]2O[CH]([CH](O)[CH]2O)N3C=CC(=O)NC3=O | CACTVS 3.341 | CCOC(=O)[C@H]1CCN(CC1)C[C@@H]2O[C@H]([C@H](O)[C@H]2O)N3C=CC(=O)NC3=O | OpenEye OEToolkits 1.5.0 | CCOC(=O)C1CCN(CC1)CC2C(C(C(O2)N3C=CC(=O)NC3=O)O)O |
|
Formula | C17 H25 N3 O7 |
Name | 1-{5-deoxy-5-[4-(ethoxycarbonyl)piperidin-1-yl]-alpha-L-arabinofuranosyl}pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058655678
|
PDB chain | 3d6o Chain A Residue 125
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|