Structure of PDB 3d3z Chain A Binding Site BS01 |
|
|
Ligand ID | D3Z |
InChI | InChI=1S/C9H12N2O5/c1-4-6(13)7(14)8(16-4)11-3-2-5(12)10-9(11)15/h2-4,6-8,13-14H,1H3,(H,10,12,15)/t4-,6+,7-,8-/m0/s1 |
InChIKey | WUBAOANSQGKRHF-UCVXFZOQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1C(C(C(O1)N2C=CC(=O)NC2=O)O)O | ACDLabs 10.04 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2O)C | CACTVS 3.341 | C[C@@H]1O[C@@H]([C@@H](O)[C@@H]1O)N2C=CC(=O)NC2=O | CACTVS 3.341 | C[CH]1O[CH]([CH](O)[CH]1O)N2C=CC(=O)NC2=O | OpenEye OEToolkits 1.5.0 | C[C@H]1[C@H]([C@@H]([C@H](O1)N2C=CC(=O)NC2=O)O)O |
|
Formula | C9 H12 N2 O5 |
Name | 1-(5-deoxy-beta-L-xylofuranosyl)pyrimidine-2,4(1H,3H)-dione |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3d3z Chain A Residue 252
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|