Structure of PDB 3d14 Chain A Binding Site BS01 |
|
|
Ligand ID | AK1 |
InChI | InChI=1S/C19H15F3N6OS2/c20-19(21,22)11-2-1-3-12(8-11)27-17(29)28-18-24-9-13(31-18)4-6-23-16-15-14(5-7-30-15)25-10-26-16/h1-3,5,7-10H,4,6H2,(H,23,25,26)(H2,24,27,28,29) |
InChIKey | JJHXPDTVQKWKHA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | FC(F)(F)c1cc(ccc1)NC(=O)Nc2ncc(s2)CCNc4ncnc3c4scc3 | CACTVS 3.341 | FC(F)(F)c1cccc(NC(=O)Nc2sc(CCNc3ncnc4ccsc34)cn2)c1 | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)NC(=O)Nc2ncc(s2)CCNc3c4c(ccs4)ncn3)C(F)(F)F |
|
Formula | C19 H15 F3 N6 O S2 |
Name | 1-{5-[2-(thieno[3,2-d]pyrimidin-4-ylamino)ethyl]-1,3-thiazol-2-yl}-3-[3-(trifluoromethyl)phenyl]urea |
ChEMBL | CHEMBL472193 |
DrugBank | DB07360 |
ZINC | ZINC000020149037
|
PDB chain | 3d14 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|